About 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine
2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine (PubChem CID 111222355) has the molecular formula C19H30F2N4O
and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine.
Molecular Properties
| Compound Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine |
| PubChem CID | 111222355 |
| Molecular Formula | C19H30F2N4O |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC1CCN(c2ccc(F)c(F)c2)C1)NCCCOCC |
| InChI | InChI=1S/C19H30F2N4O/c1-3-22-19(23-9-5-11-26-4-2)24-13-15-8-10-25(14-15)16-6-7-17(20)18(21)12-16/h6-7,12,15H,3-5,8-11,13-14H2,1-2H3,(H2,22,23,24) |
| InChIKey | WCIUYPIOYIOTOV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine?
The IUPAC name of 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine (CID 111222355) is 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine.
What is the SMILES notation for 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine?
The canonical SMILES for 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine is CCN/C(=N\CC1CCN(c2ccc(F)c(F)c2)C1)NCCCOCC.
What is the InChIKey of 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine?
The InChIKey is WCIUYPIOYIOTOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30F2N4O/c1-3-22-19(23-9-5-11-26-4-2)24-13-15-8-10-25(14-15)16-6-7-17(20)18(21)12-16/h6-7,12,15H,3-5,8-11,13-14H2,1-2H3,(H2,22,23,24).
What are the key properties of 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine?
2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine has a molecular weight of 368.47 g/mol, XLogP of 2.77, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-(3-ethoxypropyl)-3-ethylguanidine is sourced from PubChem (CID 111222355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).