C22H33NO2Si — CID 11122256
(2S,3R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-diphenylbutan-1-ol (PubChem CID 11122256) has the molecular formula C22H33NO2Si and a molecular weight of 371.60 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-diphenylbutan-1-ol.
| Compound Name | (2S,3R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-diphenylbutan-1-ol |
|---|---|
| PubChem CID | 11122256 |
| Molecular Formula | C22H33NO2Si |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (2S,3R)-2-amino-3-[tert-butyl(dimethyl)silyl]oxy-1,1-diphenylbutan-1-ol |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H33NO2Si/c1-17(25-26(5,6)21(2,3)4)20(23)22(24,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-17,20,24H,23H2,1-6H3/t17-,20+/m1/s1 |
| InChIKey | NJZDRPOVCSFNQH-XLIONFOSSA-N |
| XLogP | 4.66 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|