C20H44O2Si2 — CID 11122276
tert-butyl-[(E,1S,2R,3S,4R)-1-ethyl-2,4-dimethyl-3-trimethylsilyloxyhept-5-enoxy]-dimethylsilane (PubChem CID 11122276) has the molecular formula C20H44O2Si2 and a molecular weight of 372.74 g/mol. Its IUPAC name is tert-butyl-[(E,1S,2R,3S,4R)-1-ethyl-2,4-dimethyl-3-trimethylsilyloxyhept-5-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,1S,2R,3S,4R)-1-ethyl-2,4-dimethyl-3-trimethylsilyloxyhept-5-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11122276 |
| Molecular Formula | C20H44O2Si2 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | tert-butyl-[(E,1S,2R,3S,4R)-1-ethyl-2,4-dimethyl-3-trimethylsilyloxyhept-5-enoxy]-dimethylsilane |
| SMILES | C/C=C/[C@@H](C)[C@H](O[Si](C)(C)C)[C@H](C)[C@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H44O2Si2/c1-13-15-16(3)19(22-23(8,9)10)17(4)18(14-2)21-24(11,12)20(5,6)7/h13,15-19H,14H2,1-12H3/b15-13+/t16-,17-,18+,19+/m1/s1 |
| InChIKey | UPUFQTNNRPFQJS-GKXUBIEFSA-N |
| XLogP | 6.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|