C20H33ClN4O2 — CID 111222889
2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3-ethoxypropyl)-3-ethylguanidine (PubChem CID 111222889) has the molecular formula C20H33ClN4O2 and a molecular weight of 396.96 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3-ethoxypropyl)-3-ethylguanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3-ethoxypropyl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111222889 |
| Molecular Formula | C20H33ClN4O2 |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-1-(3-ethoxypropyl)-3-ethylguanidine |
| SMILES | CCN/C(=N\CC(c1ccc(Cl)cc1)N1CCOCC1)NCCCOCC |
| InChI | InChI=1S/C20H33ClN4O2/c1-3-22-20(23-10-5-13-26-4-2)24-16-19(25-11-14-27-15-12-25)17-6-8-18(21)9-7-17/h6-9,19H,3-5,10-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | ZJCJKZUVSPDJGD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|