C22H27NO5S — CID 11122595
(3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-benzyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 11122595) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is (3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-benzyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-benzyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 11122595 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | (3aR,4R,5R,6R,6aS)-4-(benzenesulfonylmethyl)-6-benzyl-2,2,5-trimethyl-5-oxido-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](CS(=O)(=O)c1ccccc1)[N@+](C)([O-])[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C22H27NO5S/c1-22(2)27-20-18(14-16-10-6-4-7-11-16)23(3,24)19(21(20)28-22)15-29(25,26)17-12-8-5-9-13-17/h4-13,18-21H,14-15H2,1-3H3/t18-,19+,20+,21-,23-/m1/s1 |
| InChIKey | MHUFKWGFNBORNA-DLBZZEGUSA-N |
| XLogP | 2.92 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|