C23H35NO4Si — CID 11122599
(4R)-4-benzyl-3-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11122599) has the molecular formula C23H35NO4Si and a molecular weight of 417.62 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11122599 |
| Molecular Formula | C23H35NO4Si |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO4Si/c1-16(2)20(28-29(7,8)23(4,5)6)17(3)21(25)24-19(15-27-22(24)26)14-18-12-10-9-11-13-18/h9-13,17,19-20H,1,14-15H2,2-8H3/t17-,19-,20+/m1/s1 |
| InChIKey | TXZAFRJUIHDZQY-RLLQIKCJSA-N |
| XLogP | 5.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|