C20H26BrN3O2 — CID 11122642
3-bromo-4-ethoxy-N-(6,8,8-trimethyl-1,4,5,7-tetrahydro-1,6-naphthyridin-3-yl)benzamide (PubChem CID 11122642) has the molecular formula C20H26BrN3O2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-(6,8,8-trimethyl-1,4,5,7-tetrahydro-1,6-naphthyridin-3-yl)benzamide.
| Compound Name | 3-bromo-4-ethoxy-N-(6,8,8-trimethyl-1,4,5,7-tetrahydro-1,6-naphthyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 11122642 |
| Molecular Formula | C20H26BrN3O2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-bromo-4-ethoxy-N-(6,8,8-trimethyl-1,4,5,7-tetrahydro-1,6-naphthyridin-3-yl)benzamide |
| SMILES | CCOc1ccc(C(=O)NC2=CNC3=C(C2)CN(C)CC3(C)C)cc1Br |
| InChI | InChI=1S/C20H26BrN3O2/c1-5-26-17-7-6-13(9-16(17)21)19(25)23-15-8-14-11-24(4)12-20(2,3)18(14)22-10-15/h6-7,9-10,22H,5,8,11-12H2,1-4H3,(H,23,25) |
| InChIKey | SFJUBCDPDUZVBV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |