C24H26N2O5 — CID 11122691
methyl 2-[[2-(1-butyl-4-formylpyrazol-5-yl)-5-methoxyphenoxy]methyl]benzoate (PubChem CID 11122691) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl 2-[[2-(1-butyl-4-formylpyrazol-5-yl)-5-methoxyphenoxy]methyl]benzoate.
| Compound Name | methyl 2-[[2-(1-butyl-4-formylpyrazol-5-yl)-5-methoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 11122691 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | methyl 2-[[2-(1-butyl-4-formylpyrazol-5-yl)-5-methoxyphenoxy]methyl]benzoate |
| SMILES | CCCCn1ncc(C=O)c1-c1ccc(OC)cc1OCc1ccccc1C(=O)OC |
| InChI | InChI=1S/C24H26N2O5/c1-4-5-12-26-23(18(15-27)14-25-26)21-11-10-19(29-2)13-22(21)31-16-17-8-6-7-9-20(17)24(28)30-3/h6-11,13-15H,4-5,12,16H2,1-3H3 |
| InChIKey | VKZQELPYAWMQRY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|