C12H19IN4O2 — CID 111227368
2-methyl-1-[(2-nitrophenyl)methyl]-3-propylguanidine;hydroiodide (PubChem CID 111227368) has the molecular formula C12H19IN4O2 and a molecular weight of 378.21 g/mol. Its IUPAC name is 2-methyl-1-[(2-nitrophenyl)methyl]-3-propylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-nitrophenyl)methyl]-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111227368 |
| Molecular Formula | C12H19IN4O2 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-methyl-1-[(2-nitrophenyl)methyl]-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N\C)NCc1ccccc1[N+](=O)[O-].I |
| InChI | InChI=1S/C12H18N4O2.HI/c1-3-8-14-12(13-2)15-9-10-6-4-5-7-11(10)16(17)18;/h4-7H,3,8-9H2,1-2H3,(H2,13,14,15);1H |
| InChIKey | YXEVGOOOYYHXKI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|