C24H48O2Si2 — CID 11122755
2-[(1R,4aS,8aS)-5,5,8a-trimethyl-2-trimethylsilyloxy-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 11122755) has the molecular formula C24H48O2Si2 and a molecular weight of 424.82 g/mol. Its IUPAC name is 2-[(1R,4aS,8aS)-5,5,8a-trimethyl-2-trimethylsilyloxy-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(1R,4aS,8aS)-5,5,8a-trimethyl-2-trimethylsilyloxy-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11122755 |
| Molecular Formula | C24H48O2Si2 |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | 2-[(1R,4aS,8aS)-5,5,8a-trimethyl-2-trimethylsilyloxy-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)CCC[C@]2(C)[C@@H](CCO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C24H48O2Si2/c1-22(2,3)28(10,11)25-18-15-19-20(26-27(7,8)9)13-14-21-23(4,5)16-12-17-24(19,21)6/h13,19,21H,12,14-18H2,1-11H3/t19-,21-,24+/m0/s1 |
| InChIKey | RINMUYLMLJMZPS-ZCVJKFOLSA-N |
| XLogP | 7.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|