C21H22F3NO5 — CID 11122761
2,2,2-trifluoro-N-[(2R,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetamide (PubChem CID 11122761) has the molecular formula C21H22F3NO5 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2R,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2R,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 11122761 |
| Molecular Formula | C21H22F3NO5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2R,3S,4S,5R)-2-hydroxy-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl]acetamide |
| SMILES | O=C(N[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1O)C(F)(F)F |
| InChI | InChI=1S/C21H22F3NO5/c22-21(23,24)20(27)25-17-18(29-12-15-9-5-2-6-10-15)16(30-19(17)26)13-28-11-14-7-3-1-4-8-14/h1-10,16-19,26H,11-13H2,(H,25,27)/t16-,17+,18-,19-/m1/s1 |
| InChIKey | PTRHVXJGSMRZPT-FCGDIQPGSA-N |
| XLogP | 2.55 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |