C26H41NO2Si — CID 11122809
(3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)hexan-3-ol (PubChem CID 11122809) has the molecular formula C26H41NO2Si and a molecular weight of 427.71 g/mol. Its IUPAC name is (3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)hexan-3-ol.
| Compound Name | (3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)hexan-3-ol |
|---|---|
| PubChem CID | 11122809 |
| Molecular Formula | C26H41NO2Si |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | (3S,4S)-6-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)hexan-3-ol |
| SMILES | CC[C@H](O)[C@H](CCO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H41NO2Si/c1-7-25(28)24(18-19-29-30(5,6)26(2,3)4)27(20-22-14-10-8-11-15-22)21-23-16-12-9-13-17-23/h8-17,24-25,28H,7,18-21H2,1-6H3/t24-,25-/m0/s1 |
| InChIKey | NSZWBNQEQYDBSQ-DQEYMECFSA-N |
| XLogP | 6.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|