C9H8ClF8I — CID 11122870
1-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-2-iodocyclopentane (PubChem CID 11122870) has the molecular formula C9H8ClF8I and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-2-iodocyclopentane.
| Compound Name | 1-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-2-iodocyclopentane |
|---|---|
| PubChem CID | 11122870 |
| Molecular Formula | C9H8ClF8I |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 1-(4-chloro-1,1,2,2,3,3,4,4-octafluorobutyl)-2-iodocyclopentane |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)C(F)(F)C1CCCC1I |
| InChI | InChI=1S/C9H8ClF8I/c10-9(17,18)8(15,16)7(13,14)6(11,12)4-2-1-3-5(4)19/h4-5H,1-3H2 |
| InChIKey | LFOPHMJSPRTPGU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|