C18H27IO4 — CID 11122942
(2S)-4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2-methyl-2H-furan-5-one (PubChem CID 11122942) has the molecular formula C18H27IO4 and a molecular weight of 434.31 g/mol. Its IUPAC name is (2S)-4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2S)-4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 11122942 |
| Molecular Formula | C18H27IO4 |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (2S)-4-[(3R,4Z,10E)-11-iodo-3-(methoxymethoxy)undeca-4,10-dienyl]-2-methyl-2H-furan-5-one |
| SMILES | COCO[C@@H](/C=C\CCCC/C=C/I)CCC1=C[C@H](C)OC1=O |
| InChI | InChI=1S/C18H27IO4/c1-15-13-16(18(20)23-15)10-11-17(22-14-21-2)9-7-5-3-4-6-8-12-19/h7-9,12-13,15,17H,3-6,10-11,14H2,1-2H3/b9-7-,12-8+/t15-,17-/m0/s1 |
| InChIKey | OIPUMQQOXQYQEK-AXQWODRZSA-N |
| XLogP | 4.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|