C24H32FIN4O2 — CID 111229696
1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111229696) has the molecular formula C24H32FIN4O2 and a molecular weight of 554.45 g/mol. Its IUPAC name is 1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111229696 |
| Molecular Formula | C24H32FIN4O2 |
| Molecular Weight | 554.45 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 1-[[4-(2,6-dimethylmorpholine-4-carbonyl)phenyl]methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1ccc(C(=O)N2CC(C)OC(C)C2)cc1.I |
| InChI | InChI=1S/C24H31FN4O2.HI/c1-17-15-29(16-18(2)31-17)23(30)21-8-4-20(5-9-21)14-28-24(26-3)27-13-12-19-6-10-22(25)11-7-19;/h4-11,17-18H,12-16H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | JBPGYSPAMXNWDN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|