About 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione
8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 11123022) has the molecular formula C17H19IN4O2
and a molecular weight of 438.27 g/mol. Its IUPAC name is 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione |
| PubChem CID | 11123022 |
| Molecular Formula | C17H19IN4O2 |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(I)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H19IN4O2/c1-3-9-21-15-13(16(23)22(10-4-2)17(21)24)19-14(20-15)11-5-7-12(18)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,19,20) |
| InChIKey | VLLKJIKOSLBVIW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione?
The IUPAC name of 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione (CID 11123022) is 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione.
What is the SMILES notation for 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione?
The canonical SMILES for 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione is CCCn1c(=O)c2[nH]c(-c3ccc(I)cc3)nc2n(CCC)c1=O.
What is the InChIKey of 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione?
The InChIKey is VLLKJIKOSLBVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19IN4O2/c1-3-9-21-15-13(16(23)22(10-4-2)17(21)24)19-14(20-15)11-5-7-12(18)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H,19,20).
What are the key properties of 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione?
8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione has a molecular weight of 438.27 g/mol, XLogP of 2.98, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-iodophenyl)-1,3-dipropyl-7H-purine-2,6-dione is sourced from PubChem (CID 11123022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).