C19H25FIN3O2S — CID 111230352
1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111230352) has the molecular formula C19H25FIN3O2S and a molecular weight of 505.40 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111230352 |
| Molecular Formula | C19H25FIN3O2S |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-2-methyl-3-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1ccc(CS(C)(=O)=O)cc1.I |
| InChI | InChI=1S/C19H24FN3O2S.HI/c1-21-19(22-12-11-15-7-9-18(20)10-8-15)23-13-16-3-5-17(6-4-16)14-26(2,24)25;/h3-10H,11-14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | KUIKKQXJOKRDOZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|