C24H42O5Si — CID 11123043
(4aR,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-(3-hydroxy-3-methyl-2-oxobutyl)-4,4,8a-trimethyl-2,3,4a,5,6,8-hexahydronaphthalene-1,7-dione (PubChem CID 11123043) has the molecular formula C24H42O5Si and a molecular weight of 438.68 g/mol. Its IUPAC name is (4aR,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-(3-hydroxy-3-methyl-2-oxobutyl)-4,4,8a-trimethyl-2,3,4a,5,6,8-hexahydronaphthalene-1,7-dione.
| Compound Name | (4aR,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-(3-hydroxy-3-methyl-2-oxobutyl)-4,4,8a-trimethyl-2,3,4a,5,6,8-hexahydronaphthalene-1,7-dione |
|---|---|
| PubChem CID | 11123043 |
| Molecular Formula | C24H42O5Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | (4aR,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-8-(3-hydroxy-3-methyl-2-oxobutyl)-4,4,8a-trimethyl-2,3,4a,5,6,8-hexahydronaphthalene-1,7-dione |
| SMILES | CC(C)(O)C(=O)C[C@H]1C(=O)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2C(C)(C)CCC(=O)[C@@]21C |
| InChI | InChI=1S/C24H42O5Si/c1-21(2,3)30(9,10)29-16-14-17-22(4,5)12-11-18(25)24(17,8)15(20(16)27)13-19(26)23(6,7)28/h15-17,28H,11-14H2,1-10H3/t15-,16+,17+,24+/m0/s1 |
| InChIKey | ZHRRRBBEGHIUFY-MJZZZUTASA-N |
| XLogP | 4.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|