C8Br2F9N — CID 11123076
2,6-dibromo-3,5-difluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine (PubChem CID 11123076) has the molecular formula C8Br2F9N and a molecular weight of 440.89 g/mol. Its IUPAC name is 2,6-dibromo-3,5-difluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine.
| Compound Name | 2,6-dibromo-3,5-difluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine |
|---|---|
| PubChem CID | 11123076 |
| Molecular Formula | C8Br2F9N |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 438.83 |
| IUPAC Name | 2,6-dibromo-3,5-difluoro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)pyridine |
| SMILES | Fc1c(Br)nc(Br)c(F)c1C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8Br2F9N/c9-4-2(11)1(3(12)5(10)20-4)6(13,7(14,15)16)8(17,18)19 |
| InChIKey | ZDEYVBLXIHORIG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|