C17H25FIN5O — CID 111230954
1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide (PubChem CID 111230954) has the molecular formula C17H25FIN5O and a molecular weight of 461.32 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111230954 |
| Molecular Formula | C17H25FIN5O |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-methyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C(C)C)no1)NCc1ccc(F)cc1.I |
| InChI | InChI=1S/C17H24FN5O.HI/c1-12(2)16-22-15(24-23-16)5-4-10-20-17(19-3)21-11-13-6-8-14(18)9-7-13;/h6-9,12H,4-5,10-11H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | MWFREQVVAQNJQL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|