C24H50O3Si2 — CID 11123115
(E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enal (PubChem CID 11123115) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enal.
| Compound Name | (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enal |
|---|---|
| PubChem CID | 11123115 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (E,3R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,4-trimethyl-3-trimethylsilyloxydodec-4-enal |
| SMILES | CCCCC[C@H](C/C=C(\C)[C@@H](O[Si](C)(C)C)C(C)(C)C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O3Si2/c1-13-14-15-16-21(26-29(11,12)23(3,4)5)18-17-20(2)22(24(6,7)19-25)27-28(8,9)10/h17,19,21-22H,13-16,18H2,1-12H3/b20-17+/t21-,22-/m1/s1 |
| InChIKey | QNDTWSZAHMRWFH-REJJAFBISA-N |
| XLogP | 7.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|