C30H23N3O — CID 11123124
(3aS,6aS)-3-methyl-3a,5,6,6a-tetraphenylcyclopenta[d](413C)triazol-4-one (PubChem CID 11123124) has the molecular formula C30H23N3O and a molecular weight of 443.52 g/mol. Its IUPAC name is (3aS,6aS)-3-methyl-3a,5,6,6a-tetraphenylcyclopenta[d](413C)triazol-4-one.
| Compound Name | (3aS,6aS)-3-methyl-3a,5,6,6a-tetraphenylcyclopenta[d](413C)triazol-4-one |
|---|---|
| PubChem CID | 11123124 |
| Molecular Formula | C30H23N3O |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (3aS,6aS)-3-methyl-3a,5,6,6a-tetraphenylcyclopenta[d](413C)triazol-4-one |
| SMILES | CN1N=N[C@@]2(c3ccccc3)C(c3ccccc3)=[13C](c3ccccc3)C(=O)[13C@@]12c1ccccc1 |
| InChI | InChI=1S/C30H23N3O/c1-33-30(25-20-12-5-13-21-25)28(34)26(22-14-6-2-7-15-22)27(23-16-8-3-9-17-23)29(30,31-32-33)24-18-10-4-11-19-24/h2-21H,1H3/t29-,30+/m0/s1/i26+1,30+1 |
| InChIKey | SSCJBOQYCLSSAZ-BZYBVHQCSA-N |
| XLogP | 6.28 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|