C26H28N4O4 — CID 11123392
2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]-6-methyl-1-oxobenzo[b][1,6]naphthyridine-4-carboxamide (PubChem CID 11123392) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]-6-methyl-1-oxobenzo[b][1,6]naphthyridine-4-carboxamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]-6-methyl-1-oxobenzo[b][1,6]naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 11123392 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[2-(dimethylamino)ethyl]-6-methyl-1-oxobenzo[b][1,6]naphthyridine-4-carboxamide |
| SMILES | COc1ccc(-n2cc(C(=O)NCCN(C)C)c3nc4c(C)cccc4cc3c2=O)cc1OC |
| InChI | InChI=1S/C26H28N4O4/c1-16-7-6-8-17-13-19-24(28-23(16)17)20(25(31)27-11-12-29(2)3)15-30(26(19)32)18-9-10-21(33-4)22(14-18)34-5/h6-10,13-15H,11-12H2,1-5H3,(H,27,31) |
| InChIKey | GNEBWYREXBRIFC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|