C15H23BrF2IN3O2 — CID 111234536
2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 111234536) has the molecular formula C15H23BrF2IN3O2 and a molecular weight of 522.17 g/mol. Its IUPAC name is 2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111234536 |
| Molecular Formula | C15H23BrF2IN3O2 |
| Molecular Weight | 522.17 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | 2-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-ethyl-3-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Br)ccc1OC(F)F)NC(C)COC.I |
| InChI | InChI=1S/C15H22BrF2N3O2.HI/c1-4-19-15(21-10(2)9-22-3)20-8-11-7-12(16)5-6-13(11)23-14(17)18;/h5-7,10,14H,4,8-9H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | JIUJZPXZXWKOTM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.17 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|