C18H31IN4O3 — CID 111234768
N-ethyl-2-[3-[[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111234768) has the molecular formula C18H31IN4O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-ethyl-2-[3-[[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[3-[[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111234768 |
| Molecular Formula | C18H31IN4O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-ethyl-2-[3-[[[ethylamino-(1-methoxypropan-2-ylamino)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCNC(=O)COc1cccc(C/N=C(\NCC)NC(C)COC)c1.I |
| InChI | InChI=1S/C18H30N4O3.HI/c1-5-19-17(23)13-25-16-9-7-8-15(10-16)11-21-18(20-6-2)22-14(3)12-24-4;/h7-10,14H,5-6,11-13H2,1-4H3,(H,19,23)(H2,20,21,22);1H |
| InChIKey | NNVKEQWHZDFYOI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|