C27H40O5Si — CID 11123563
(2S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexane-2,4-diol (PubChem CID 11123563) has the molecular formula C27H40O5Si and a molecular weight of 472.70 g/mol. Its IUPAC name is (2S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexane-2,4-diol.
| Compound Name | (2S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexane-2,4-diol |
|---|---|
| PubChem CID | 11123563 |
| Molecular Formula | C27H40O5Si |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2S,4S)-6-[tert-butyl(diphenyl)silyl]oxy-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexane-2,4-diol |
| SMILES | CC1(C)OC[C@H](C[C@@H](O)C[C@@H](O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C27H40O5Si/c1-26(2,3)33(24-12-8-6-9-13-24,25-14-10-7-11-15-25)31-17-16-21(28)18-22(29)19-23-20-30-27(4,5)32-23/h6-15,21-23,28-29H,16-20H2,1-5H3/t21-,22-,23-/m0/s1 |
| InChIKey | WXVOOICHXANVPA-VABKMULXSA-N |
| XLogP | 3.61 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|