About [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride
[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride (PubChem CID 11123579) has the molecular formula C28H25ClNO2P
and a molecular weight of 473.94 g/mol. Its IUPAC name is [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride.
Molecular Properties
| Compound Name | [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride |
| PubChem CID | 11123579 |
| Molecular Formula | C28H25ClNO2P |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C28H25NO2P.ClH/c30-28-29(27(21-31-28)23-13-5-1-6-14-23)22-32(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h1-20,27H,21-22H2;1H/q+1;/p-1/t27-;/m0./s1 |
| InChIKey | IPTUBZSFMGLADH-YCBFMBTMSA-M |
| XLogP | 2.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride?
The IUPAC name of [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride (CID 11123579) is [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride.
What is the SMILES notation for [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride?
The canonical SMILES for [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride is O=C1OC[C@@H](c2ccccc2)N1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Cl-].
What is the InChIKey of [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride?
The InChIKey is IPTUBZSFMGLADH-YCBFMBTMSA-M. The full InChI is InChI=1S/C28H25NO2P.ClH/c30-28-29(27(21-31-28)23-13-5-1-6-14-23)22-32(24-15-7-2-8-16-24,25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h1-20,27H,21-22H2;1H/q+1;/p-1/t27-;/m0./s1.
What are the key properties of [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride?
[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride has a molecular weight of 473.94 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]methyl-triphenylphosphanium chloride is sourced from PubChem (CID 11123579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).