C22H40O9Si — CID 11123626
(2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(methoxymethoxymethyl)-2H-pyran-5-one (PubChem CID 11123626) has the molecular formula C22H40O9Si and a molecular weight of 476.64 g/mol. Its IUPAC name is (2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(methoxymethoxymethyl)-2H-pyran-5-one.
| Compound Name | (2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(methoxymethoxymethyl)-2H-pyran-5-one |
|---|---|
| PubChem CID | 11123626 |
| Molecular Formula | C22H40O9Si |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-bis(methoxymethoxymethyl)-2H-pyran-5-one |
| SMILES | COCOCC1=C(COCOC)[C@H](O[Si](C)(C)C(C)(C)C)O[C@@H]([C@@H]2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C22H40O9Si/c1-21(2,3)32(8,9)31-20-16(11-27-14-25-7)15(10-26-13-24-6)18(23)19(29-20)17-12-28-22(4,5)30-17/h17,19-20H,10-14H2,1-9H3/t17-,19-,20-/m0/s1 |
| InChIKey | PCSRHEZGMHESGW-IHPCNDPISA-N |
| XLogP | 2.99 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|