C31H50N4O — CID 11123873
4-[2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethyl]morpholine (PubChem CID 11123873) has the molecular formula C31H50N4O and a molecular weight of 494.77 g/mol. Its IUPAC name is 4-[2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethyl]morpholine.
| Compound Name | 4-[2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 11123873 |
| Molecular Formula | C31H50N4O |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | 4-[2-[(3aS,6aR)-5-phenyl-1'-(4-propan-2-ylcyclohexyl)spiro[3,3a,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-4,4'-piperidine]-2-yl]ethyl]morpholine |
| SMILES | CC(C)C1CCC(N2CCC3(CC2)[C@@H]2CN(CCN4CCOCC4)C[C@@H]2CN3c2ccccc2)CC1 |
| InChI | InChI=1S/C31H50N4O/c1-25(2)26-8-10-28(11-9-26)34-14-12-31(13-15-34)30-24-33(17-16-32-18-20-36-21-19-32)22-27(30)23-35(31)29-6-4-3-5-7-29/h3-7,25-28,30H,8-24H2,1-2H3/t26?,27-,28?,30-/m1/s1 |
| InChIKey | YYERVMPUPRTTKH-AIXHKUCGSA-N |
| XLogP | 4.44 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |