C21H20N8O5S — CID 11123887
4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonic acid (PubChem CID 11123887) has the molecular formula C21H20N8O5S and a molecular weight of 496.51 g/mol. Its IUPAC name is 4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonic acid.
| Compound Name | 4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 11123887 |
| Molecular Formula | C21H20N8O5S |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 4-[[11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]benzenesulfonic acid |
| SMILES | CCCCn1cc2c(nc(NC(=O)Nc3ccc(S(=O)(=O)O)cc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C21H20N8O5S/c1-2-3-10-28-12-15-17(26-28)24-20(29-19(15)23-18(27-29)16-5-4-11-34-16)25-21(30)22-13-6-8-14(9-7-13)35(31,32)33/h4-9,11-12H,2-3,10H2,1H3,(H,31,32,33)(H2,22,24,25,26,30) |
| InChIKey | CUKROFJHIKPBQG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 169.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|