C19H33IN4O2 — CID 111239456
2-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide (PubChem CID 111239456) has the molecular formula C19H33IN4O2 and a molecular weight of 476.40 g/mol. Its IUPAC name is 2-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111239456 |
| Molecular Formula | C19H33IN4O2 |
| Molecular Weight | 476.40 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[[N-(3-butoxypropyl)-N'-methylcarbamimidoyl]amino]-N-(3-ethylphenyl)acetamide;hydroiodide |
| SMILES | CCCCOCCCN/C(=N\C)NCC(=O)Nc1cccc(CC)c1.I |
| InChI | InChI=1S/C19H32N4O2.HI/c1-4-6-12-25-13-8-11-21-19(20-3)22-15-18(24)23-17-10-7-9-16(5-2)14-17;/h7,9-10,14H,4-6,8,11-13,15H2,1-3H3,(H,23,24)(H2,20,21,22);1H |
| InChIKey | DREJEUQUYWWETI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|