About 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline
4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline (PubChem CID 11123999) has the molecular formula C28H29ClN4O3
and a molecular weight of 505.02 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline.
Molecular Properties
| Compound Name | 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline |
| PubChem CID | 11123999 |
| Molecular Formula | C28H29ClN4O3 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline |
| SMILES | COc1cc2c(N3CCN(Cc4ccccc4)CC3)nc(-c3ccc(Cl)cc3)nc2c(OC)c1OC |
| InChI | InChI=1S/C28H29ClN4O3/c1-34-23-17-22-24(26(36-3)25(23)35-2)30-27(20-9-11-21(29)12-10-20)31-28(22)33-15-13-32(14-16-33)18-19-7-5-4-6-8-19/h4-12,17H,13-16,18H2,1-3H3 |
| InChIKey | OCIIOYARYBCDRO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 59.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline?
The IUPAC name of 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline (CID 11123999) is 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline.
What is the SMILES notation for 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline?
The canonical SMILES for 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline is COc1cc2c(N3CCN(Cc4ccccc4)CC3)nc(-c3ccc(Cl)cc3)nc2c(OC)c1OC.
What is the InChIKey of 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline?
The InChIKey is OCIIOYARYBCDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29ClN4O3/c1-34-23-17-22-24(26(36-3)25(23)35-2)30-27(20-9-11-21(29)12-10-20)31-28(22)33-15-13-32(14-16-33)18-19-7-5-4-6-8-19/h4-12,17H,13-16,18H2,1-3H3.
What are the key properties of 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline?
4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline has a molecular weight of 505.02 g/mol, XLogP of 5.30, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-6,7,8-trimethoxyquinazoline is sourced from PubChem (CID 11123999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).