About [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate
[(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate (PubChem CID 11124013) has the molecular formula C24H26O8S2
and a molecular weight of 506.60 g/mol. Its IUPAC name is [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate.
Molecular Properties
| Compound Name | [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate |
| PubChem CID | 11124013 |
| Molecular Formula | C24H26O8S2 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate |
| SMILES | C=CCC(C/C=C/C(OC(C)=O)OC(C)=O)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26O8S2/c1-4-17-24(33(27,28)21-12-7-5-8-13-21,34(29,30)22-14-9-6-10-15-22)18-11-16-23(31-19(2)25)32-20(3)26/h4-16,23H,1,17-18H2,2-3H3/b16-11+ |
| InChIKey | PVGPFTXUEBIJPL-LFIBNONCSA-N |
| XLogP | 3.61 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate?
The IUPAC name of [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate (CID 11124013) is [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate.
What is the SMILES notation for [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate?
The canonical SMILES for [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate is C=CCC(C/C=C/C(OC(C)=O)OC(C)=O)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate?
The InChIKey is PVGPFTXUEBIJPL-LFIBNONCSA-N. The full InChI is InChI=1S/C24H26O8S2/c1-4-17-24(33(27,28)21-12-7-5-8-13-21,34(29,30)22-14-9-6-10-15-22)18-11-16-23(31-19(2)25)32-20(3)26/h4-16,23H,1,17-18H2,2-3H3/b16-11+.
What are the key properties of [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate?
[(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate has a molecular weight of 506.60 g/mol, XLogP of 3.61, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-1-acetyloxy-5,5-bis(benzenesulfonyl)octa-2,7-dienyl] acetate is sourced from PubChem (CID 11124013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).