About ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate
ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate (PubChem CID 11124113) has the molecular formula C28H39NO6Si
and a molecular weight of 513.71 g/mol. Its IUPAC name is ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate |
| PubChem CID | 11124113 |
| Molecular Formula | C28H39NO6Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate |
| SMILES | CCOC(=O)C(CCC1OCCCO1)C(=O)N(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H39NO6Si/c1-6-32-27(31)24(18-19-25-33-20-13-21-34-25)26(30)29(5)35-36(28(2,3)4,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,24-25H,6,13,18-21H2,1-5H3 |
| InChIKey | UOALFWXIVUGMLT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate?
The IUPAC name of ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate (CID 11124113) is ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate.
What is the SMILES notation for ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate?
The canonical SMILES for ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate is CCOC(=O)C(CCC1OCCCO1)C(=O)N(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate?
The InChIKey is UOALFWXIVUGMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H39NO6Si/c1-6-32-27(31)24(18-19-25-33-20-13-21-34-25)26(30)29(5)35-36(28(2,3)4,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h7-12,14-17,24-25H,6,13,18-21H2,1-5H3.
What are the key properties of ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate?
ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate has a molecular weight of 513.71 g/mol, XLogP of 3.66, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[tert-butyl(diphenyl)silyl]oxy-methylcarbamoyl]-4-(1,3-dioxan-2-yl)butanoate is sourced from PubChem (CID 11124113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).