C30H42O6Si — CID 11124257
(1S)-1-[(2R,4aR,6R,7S,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylmethoxypropan-2-one (PubChem CID 11124257) has the molecular formula C30H42O6Si and a molecular weight of 526.75 g/mol. Its IUPAC name is (1S)-1-[(2R,4aR,6R,7S,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylmethoxypropan-2-one.
| Compound Name | (1S)-1-[(2R,4aR,6R,7S,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylmethoxypropan-2-one |
|---|---|
| PubChem CID | 11124257 |
| Molecular Formula | C30H42O6Si |
| Molecular Weight | 526.75 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | (1S)-1-[(2R,4aR,6R,7S,8R,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]-1-phenylmethoxypropan-2-one |
| SMILES | CC(=O)[C@@H](OCc1ccccc1)[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C30H42O6Si/c1-20-25(27(21(2)31)32-18-22-14-10-8-11-15-22)34-24-19-33-29(23-16-12-9-13-17-23)35-28(24)26(20)36-37(6,7)30(3,4)5/h8-17,20,24-29H,18-19H2,1-7H3/t20-,24+,25+,26+,27+,28+,29+/m0/s1 |
| InChIKey | GFBNBYAABJSXBF-LFPDSMOASA-N |
| XLogP | 6.07 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.75 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|