C23H32N6O2 — CID 111242927
4-(4-methoxyphenyl)-N'-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111242927) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N'-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-methoxyphenyl)-N'-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111242927 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-(4-methoxyphenyl)-N'-methyl-N-[(2-morpholin-4-yl-3-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1cccnc1N1CCOCC1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H32N6O2/c1-24-23(26-18-19-4-3-9-25-22(19)28-14-16-31-17-15-28)29-12-10-27(11-13-29)20-5-7-21(30-2)8-6-20/h3-9H,10-18H2,1-2H3,(H,24,26) |
| InChIKey | DNEQNIYRAKKDED-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|