C34H54O3Si2 — CID 11124621
(2R,3S)-2-[tert-butyl(diphenyl)silyl]oxy-9-tri(propan-2-yl)silyloxynon-5-yn-3-ol (PubChem CID 11124621) has the molecular formula C34H54O3Si2 and a molecular weight of 566.98 g/mol. Its IUPAC name is (2R,3S)-2-[tert-butyl(diphenyl)silyl]oxy-9-tri(propan-2-yl)silyloxynon-5-yn-3-ol.
| Compound Name | (2R,3S)-2-[tert-butyl(diphenyl)silyl]oxy-9-tri(propan-2-yl)silyloxynon-5-yn-3-ol |
|---|---|
| PubChem CID | 11124621 |
| Molecular Formula | C34H54O3Si2 |
| Molecular Weight | 566.98 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | (2R,3S)-2-[tert-butyl(diphenyl)silyl]oxy-9-tri(propan-2-yl)silyloxynon-5-yn-3-ol |
| SMILES | CC(C)[Si](OCCCC#CC[C@H](O)[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C34H54O3Si2/c1-27(2)38(28(3)4,29(5)6)36-26-20-12-11-19-25-33(35)30(7)37-39(34(8,9)10,31-21-15-13-16-22-31)32-23-17-14-18-24-32/h13-18,21-24,27-30,33,35H,12,20,25-26H2,1-10H3/t30-,33+/m1/s1 |
| InChIKey | DKGFXBXHFVYOBZ-NDKRRWIDSA-N |
| XLogP | 7.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.98 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|