C29H37IO4 — CID 11124685
(2-iodo-4-methylphenyl) (3R,5S,8R,9S,10S,13S,14S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 11124685) has the molecular formula C29H37IO4 and a molecular weight of 576.52 g/mol. Its IUPAC name is (2-iodo-4-methylphenyl) (3R,5S,8R,9S,10S,13S,14S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | (2-iodo-4-methylphenyl) (3R,5S,8R,9S,10S,13S,14S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 11124685 |
| Molecular Formula | C29H37IO4 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | (2-iodo-4-methylphenyl) (3R,5S,8R,9S,10S,13S,14S)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)C(C(=O)Oc4ccc(C)cc4I)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H37IO4/c1-17-5-10-26(25(30)15-17)34-27(32)24-9-8-22-21-7-6-19-16-20(33-18(2)31)11-13-28(19,3)23(21)12-14-29(22,24)4/h5,9-10,15,19-23H,6-8,11-14,16H2,1-4H3/t19-,20+,21-,22-,23-,28-,29-/m0/s1 |
| InChIKey | KLQWPNOARYYWHW-SNHQIJRISA-N |
| XLogP | 7.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|