C33H39Cl2N5 — CID 11124688
N'-[3-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-N'-methyl-N-(1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine (PubChem CID 11124688) has the molecular formula C33H39Cl2N5 and a molecular weight of 576.62 g/mol. Its IUPAC name is N'-[3-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-N'-methyl-N-(1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine.
| Compound Name | N'-[3-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-N'-methyl-N-(1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 11124688 |
| Molecular Formula | C33H39Cl2N5 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | N'-[3-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]propyl]-N'-methyl-N-(1,2,3,4-tetrahydroacridin-9-yl)propane-1,3-diamine |
| SMILES | CN(CCCNc1c2c(nc3ccccc13)CCCC2)CCCNc1c2c(nc3cc(Cl)cc(Cl)c13)CCCC2 |
| InChI | InChI=1S/C33H39Cl2N5/c1-40(18-8-16-36-32-23-10-2-5-13-27(23)38-28-14-6-3-11-24(28)32)19-9-17-37-33-25-12-4-7-15-29(25)39-30-21-22(34)20-26(35)31(30)33/h2,5,10,13,20-21H,3-4,6-9,11-12,14-19H2,1H3,(H,36,38)(H,37,39) |
| InChIKey | UBICYFGZMQMCLZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|