C24H26F9NO3S — CID 11124706
[3,5-ditert-butyl-2-(3-methyl-2-pyridinyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 11124706) has the molecular formula C24H26F9NO3S and a molecular weight of 579.53 g/mol. Its IUPAC name is [3,5-ditert-butyl-2-(3-methyl-2-pyridinyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [3,5-ditert-butyl-2-(3-methyl-2-pyridinyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 11124706 |
| Molecular Formula | C24H26F9NO3S |
| Molecular Weight | 579.53 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | [3,5-ditert-butyl-2-(3-methyl-2-pyridinyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1cccnc1-c1c(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C24H26F9NO3S/c1-13-9-8-10-34-18(13)17-15(20(5,6)7)11-14(19(2,3)4)12-16(17)37-38(35,36)24(32,33)22(27,28)21(25,26)23(29,30)31/h8-12H,1-7H3 |
| InChIKey | FKJKTLPDKVGAKZ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.53 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|