C21H39IN6O — CID 111247510
2-(dimethylamino)-N-[3-[[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide (PubChem CID 111247510) has the molecular formula C21H39IN6O and a molecular weight of 518.49 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[3-[[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide.
| Compound Name | 2-(dimethylamino)-N-[3-[[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111247510 |
| Molecular Formula | C21H39IN6O |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 2-(dimethylamino)-N-[3-[[[N-[2-[di(propan-2-yl)amino]ethyl]-N'-methylcarbamimidoyl]amino]methyl]phenyl]acetamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCc1cccc(NC(=O)CN(C)C)c1.I |
| InChI | InChI=1S/C21H38N6O.HI/c1-16(2)27(17(3)4)12-11-23-21(22-5)24-14-18-9-8-10-19(13-18)25-20(28)15-26(6)7;/h8-10,13,16-17H,11-12,14-15H2,1-7H3,(H,25,28)(H2,22,23,24);1H |
| InChIKey | IYMCZUPVGPXXFQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|