C17H31N5O — CID 111248669
1-[2-[di(propan-2-yl)amino]ethyl]-3-[(2-methoxy-3-pyridinyl)methyl]-2-methylguanidine (PubChem CID 111248669) has the molecular formula C17H31N5O and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-3-[(2-methoxy-3-pyridinyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-[(2-methoxy-3-pyridinyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111248669 |
| Molecular Formula | C17H31N5O |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-3-[(2-methoxy-3-pyridinyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCc1cccnc1OC |
| InChI | InChI=1S/C17H31N5O/c1-13(2)22(14(3)4)11-10-20-17(18-5)21-12-15-8-7-9-19-16(15)23-6/h7-9,13-14H,10-12H2,1-6H3,(H2,18,20,21) |
| InChIKey | WYETVYHGHKFEIM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|