C18H33N5O2S — CID 111248775
1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111248775) has the molecular formula C18H33N5O2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111248775 |
| Molecular Formula | C18H33N5O2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc(S(N)(=O)=O)cc1)NCCN(C(C)C)C(C)C |
| InChI | InChI=1S/C18H33N5O2S/c1-14(2)23(15(3)4)13-12-22-18(20-5)21-11-10-16-6-8-17(9-7-16)26(19,24)25/h6-9,14-15H,10-13H2,1-5H3,(H2,19,24,25)(H2,20,21,22) |
| InChIKey | LIFUOMYKYOXVPS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|