C21H26F3N3O3 — CID 111248921
1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111248921) has the molecular formula C21H26F3N3O3 and a molecular weight of 425.45 g/mol. Its IUPAC name is 1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111248921 |
| Molecular Formula | C21H26F3N3O3 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-ethyl-2-[(3-methoxyphenyl)methyl]-3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1)NCc1ccc(OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C21H26F3N3O3/c1-4-25-20(26-12-15-6-5-7-17(10-15)28-2)27-13-16-8-9-18(19(11-16)29-3)30-14-21(22,23)24/h5-11H,4,12-14H2,1-3H3,(H2,25,26,27) |
| InChIKey | HITFJPVCZUFHLQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|