C29H40O14 — CID 11124918
methyl (1S,2R,3S,4R,7S,8E,10R,12R,13R,14S,16S,17R)-2,10,12,14-tetraacetyloxy-3,16-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-ene-9-carboxylate (PubChem CID 11124918) has the molecular formula C29H40O14 and a molecular weight of 612.62 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R,7S,8E,10R,12R,13R,14S,16S,17R)-2,10,12,14-tetraacetyloxy-3,16-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-ene-9-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R,7S,8E,10R,12R,13R,14S,16S,17R)-2,10,12,14-tetraacetyloxy-3,16-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-ene-9-carboxylate |
|---|---|
| PubChem CID | 11124918 |
| Molecular Formula | C29H40O14 |
| Molecular Weight | 612.62 g/mol |
| Exact Mass | 612.24 |
| IUPAC Name | methyl (1S,2R,3S,4R,7S,8E,10R,12R,13R,14S,16S,17R)-2,10,12,14-tetraacetyloxy-3,16-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-8-ene-9-carboxylate |
| SMILES | COC(=O)/C1=C/[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@H](OC(C)=O)[C@H]2[C@@H](C)[C@@H](O)C[C@H](OC(C)=O)[C@]2(C)[C@H](OC(C)=O)C[C@H]1OC(C)=O |
| InChI | InChI=1S/C29H40O14/c1-12-19(34)10-21(40-15(4)31)28(7)22(41-16(5)32)11-20(39-14(3)30)18(27(36)38-8)9-23-29(37,13(2)26(35)43-23)25(24(12)28)42-17(6)33/h9,12-13,19-25,34,37H,10-11H2,1-8H3/b18-9+/t12-,13-,19-,20+,21-,22+,23-,24+,25+,28+,29-/m0/s1 |
| InChIKey | KWLNKPHVFOFLTM-JUERNPNPSA-N |
| XLogP | 0.53 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.62 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|