C29H51Cl3O7Si — CID 11125126
2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-4,10-dihydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-tri(propan-2-yl)silyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 11125126) has the molecular formula C29H51Cl3O7Si and a molecular weight of 646.17 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-4,10-dihydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-tri(propan-2-yl)silyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | 2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-4,10-dihydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-tri(propan-2-yl)silyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 11125126 |
| Molecular Formula | C29H51Cl3O7Si |
| Molecular Weight | 646.17 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(2S,4S,6S,8R,10S)-4,10-dihydroxy-4-methyl-2-[(3R)-3-methyl-2-methylidene-4-tri(propan-2-yl)silyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | C=C(C[C@H]1C[C@](C)(O)C[C@@]2(C[C@@H](O)C[C@H](CC(=O)OCC(Cl)(Cl)Cl)O2)O1)[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H51Cl3O7Si/c1-18(2)40(19(3)4,20(5)6)37-15-22(8)21(7)10-25-14-27(9,35)16-28(39-25)13-23(33)11-24(38-28)12-26(34)36-17-29(30,31)32/h18-20,22-25,33,35H,7,10-17H2,1-6,8-9H3/t22-,23-,24+,25-,27-,28+/m0/s1 |
| InChIKey | VIFQDBOOHCKPBK-FLKASFRGSA-N |
| XLogP | 7.23 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.17 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|