C27H30IN5O — CID 111251598
1-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111251598) has the molecular formula C27H30IN5O and a molecular weight of 567.48 g/mol. Its IUPAC name is 1-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111251598 |
| Molecular Formula | C27H30IN5O |
| Molecular Weight | 567.48 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 1-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-3-[(3-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OC)c1)NCc1ccccc1-c1ccc(Cn2ccnc2)cc1.I |
| InChI | InChI=1S/C27H29N5O.HI/c1-28-27(30-17-22-6-5-8-25(16-22)33-2)31-18-24-7-3-4-9-26(24)23-12-10-21(11-13-23)19-32-15-14-29-20-32;/h3-16,20H,17-19H2,1-2H3,(H2,28,30,31);1H |
| InChIKey | XNZHPEDYWPSICP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|