C16H25N3O2S — CID 111252059
methyl 1-[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252059) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is methyl 1-[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252059 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | methyl 1-[N-[(5-ethylthiophen-2-yl)methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCc1ccc(CN/C(=N\C)N2CCC(C(=O)OC)CC2)s1 |
| InChI | InChI=1S/C16H25N3O2S/c1-4-13-5-6-14(22-13)11-18-16(17-2)19-9-7-12(8-10-19)15(20)21-3/h5-6,12H,4,7-11H2,1-3H3,(H,17,18) |
| InChIKey | DJANQSUZPQHUOV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|