C25H36OSi — CID 11125220
tert-butyl-dimethyl-[[(7Z)-8,15,15-trimethyl-4-methylidene-1-bicyclo[9.3.1]pentadeca-7,11-dien-2,9-diynyl]oxy]silane (PubChem CID 11125220) has the molecular formula C25H36OSi and a molecular weight of 380.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(7Z)-8,15,15-trimethyl-4-methylidene-1-bicyclo[9.3.1]pentadeca-7,11-dien-2,9-diynyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(7Z)-8,15,15-trimethyl-4-methylidene-1-bicyclo[9.3.1]pentadeca-7,11-dien-2,9-diynyl]oxy]silane |
|---|---|
| PubChem CID | 11125220 |
| Molecular Formula | C25H36OSi |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl-dimethyl-[[(7Z)-8,15,15-trimethyl-4-methylidene-1-bicyclo[9.3.1]pentadeca-7,11-dien-2,9-diynyl]oxy]silane |
| SMILES | C=C1C#CC2(O[Si](C)(C)C(C)(C)C)CCC=C(C#C/C(C)=C/CC1)C2(C)C |
| InChI | InChI=1S/C25H36OSi/c1-20-12-10-13-21(2)17-19-25(26-27(8,9)23(3,4)5)18-11-14-22(16-15-20)24(25,6)7/h12,14H,2,10-11,13,18H2,1,3-9H3/b20-12+ |
| InChIKey | LKVKURAHQJKIBT-UDWIEESQSA-N |
| XLogP | 6.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|