C18H26FN3O2 — CID 111252217
methyl 1-[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111252217) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is methyl 1-[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111252217 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | methyl 1-[N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C18H26FN3O2/c1-4-20-18(21-12-14-6-5-13(2)16(19)11-14)22-9-7-15(8-10-22)17(23)24-3/h5-6,11,15H,4,7-10,12H2,1-3H3,(H,20,21) |
| InChIKey | LZOYEXXZVMHDSY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|